
CAS 890928-81-1: (13α,14β,17α,20S,24S)-24,25-Epoxylanost-7-ene-3,23-dione
Formula:C30H46O3
InChI:InChI=1S/C30H46O3/c1-18(17-22(31)25-27(4,5)33-25)19-11-15-30(8)21-9-10-23-26(2,3)24(32)13-14-28(23,6)20(21)12-16-29(19,30)7/h9,18-20,23,25H,10-17H2,1-8H3/t18-,19-,20-,23-,25+,28+,29-,30+/m0/s1
InChI key:InChIKey=LLEVBDQGRCWBIO-SBRRLATOSA-N
SMILES:C[C@@]12C=3[C@@]([C@]4(C)[C@@](CC3)(C(C)(C)C(=O)CC4)[H])(CC[C@@]1(C)[C@]([C@H](CC(=O)[C@@H]5C(C)(C)O5)C)(CC2)[H])[H]
Synonyms:- Lanost-7-ene-3,23-dione, 24,25-epoxy-, (13α,14β,17α,20S,24S)-
- (13α,14β,17α,20S,24S)-24,25-Epoxylanost-7-ene-3,23-dione
- 24,25-Epoxytirucall-7-ene-3,23-dione
Sort by
Found 3 products.
24,25-Epoxytirucall-7-en-3,23-dione
CAS:Formula:C30H46O3Purity:95%~99%Color and Shape:PowderMolecular weight:454.69524,25-Epoxytirucall-7-en-3,23-dione
CAS:24,25-Epoxytirucall-7-en-3,23-dione is a triterpenoid compound, which is typically derived from plant sources such as those belonging to the Sapotaceae family. This compound is interesting for its structural complexity and potential bioactive properties. It is isolated through methods like solvent extraction, followed by purification techniques such as chromatography. The mode of action of 24,25-Epoxytirucall-7-en-3,23-dione is not fully understood, but as a triterpenoid, it might interact with various biological pathways, influencing enzyme activities, signaling pathways, or receptor interactions. Its structural features suggest potential utility in modulating inflammatory responses or exhibiting cytotoxic activity against certain cancer cell lines. In scientific research, 24,25-Epoxytirucall-7-en-3,23-dione is primarily investigated for its pharmacological potential. Studies focus on its anti-inflammatory, antioxidant, or anticancer properties, making it a compound of interest for drug discovery. Moreover, its significance also extends to the study of plant metabolism and biosynthesis pathways, providing insights into the ecological roles and evolutionary aspects of plant secondary metabolites.Formula:C30H46O3Purity:Min. 95%Molecular weight:454.7 g/mol24,25-Epoxytirucall-7-en-3,23-dione
CAS:24,25-Epoxytirucall-7-en-3,23-dione is a natural product for research related to life sciences. The catalog number is TN2819 and the CAS number is 890928-81-1.Formula:C30H46O3Purity:98%Color and Shape:SolidMolecular weight:454.695