
CAS 89281-13-0: 2,6-dichloroisonicotinamide
Formula:C6H4Cl2N2O
InChI:InChI=1/C6H4Cl2N2O/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H,(H2,9,11)
SMILES:c1c(cc(Cl)nc1Cl)C(=N)O
Synonyms:- 4-[3-(Dimethylamino)Propyl]Aniline
- 2,6-Dichloropyridine-4-Carboxamide
Sort by
Found 4 products.
2,6-Dichloroisonicotinamide
CAS:2,6-DichloroisonicotinamideFormula:C6H4Cl2N2OPurity:95%Color and Shape:White SolidMolecular weight:191.01g/mol2,6-Dichloroisonicotinamide
CAS:Formula:C6H4Cl2N2OPurity:95%Color and Shape:SolidMolecular weight:191.01482,6-Dichloroisonicotinamide
CAS:2,6-Dichloroisonicotinamide is a molecule that has been optimized for antibacterial activity. The molecule has a pyrrole ring and two heterocycles, which are substituted at the 6-position on the pyrrole. The compound is active against bacterial species such as Escherichia coli, Pseudomonas aeruginosa, and Staphylococcus aureus. 2,6-Dichloroisonicotinamide inhibits bacterial growth by binding to DNA gyrase and topoisomerase IV enzymes in the bacterial cell membrane. This binding prevents these enzymes from maintaining the integrity of bacterial DNA by preventing them from binding to DNA and causing cross-linking of DNA strands. 2,6-Dichloroisonicotinamide also induces death of cells by inhibiting cellular respiration.Formula:C6H4Cl2N2OPurity:Min. 95%Molecular weight:191.01 g/molRef: 3D-FD149330
Discontinued product