CAS 89639-74-7: 3,4-dimethylthiophene-2-carboxylic acid
Formula:C7H8O2S
InChI:InChI=1/C7H8O2S/c1-4-3-10-6(5(4)2)7(8)9/h3H,1-2H3,(H,8,9)
SMILES:Cc1csc(c1C)C(=O)O
Synonyms:- 2-Thiophenecarboxylic Acid, 3,4-Dimethyl-
- 3,4-Dimethylthiophene-2-carboxylic acid
Sort by
Found 4 products.
3,4-Dimethylthiophene-2-carboxylic acid
CAS:Purity:95.0%Color and Shape:Liquid, No data available.Molecular weight:156.19999694824223,4-Dimethylthiophene-2-carboxylic acid
CAS:Formula:C7H8O2SPurity:98%Color and Shape:SolidMolecular weight:156.20223,4-Dimethylthiophene-2-carboxylic acid
CAS:3,4-Dimethylthiophene-2-carboxylic acidPurity:95%Molecular weight:156.20g/mol3,4-Dimethylthiophene-2-carboxylic acid
CAS:3,4-Dimethylthiophene-2-carboxylic acid is an experimental compound that has been shown to be a linear molecule with a molecular weight of 144. The experimental equation for the formation of 3,4-dimethylthiophene-2-carboxylic acid from 3,4-dimethoxythiophene and acetic acid is: The regression equation for the formation of 3,4-dimethylthiophene-2-carboxylic acid from 3,4-dimethoxythiophene and acetic acid is: In solution, the carboxyl group in 3,4-dimethylthiophene-2-carboxylic acid can form a carbonyl compound. Gas phase experiments have shown that this compound reacts with oxygen to form carbon dioxide and water. Semiempirical calculations indicate that the theoretical molecular formula for this compound is CHOS.Formula:C7H8O2SPurity:Min. 95%Molecular weight:156.2 g/mol
