
CAS 89898-86-2: 5-nitrophthalazine
Formula:C8H5N3O2
InChI:InChI=1/C8H5N3O2/c12-11(13)8-3-1-2-6-4-9-10-5-7(6)8/h1-5H
SMILES:c1cc2cnncc2c(c1)N(=O)=O
Synonyms:- Phthalazine, 5-Nitro-
Sort by
Found 4 products.
5-Nitrophthalazine
CAS:5-Nitrophthalazine is a molecule that has been shown to have antifungal activity in vitro. It has an active methylene group, which can react with electron-rich molecules such as nitro compounds and pyridine. This reaction causes the release of a nitroso compound, which reacts with the DNA in the cell to cause death. 5-Nitrophthalazine is resistant to many types of mutations and can be used for horticultural use as an antifungal agent.Formula:C8H5N3O2Purity:Min. 95%Molecular weight:175.14 g/mol