CAS 91004-61-4: Quinoline, 8-hydrazinyl-, hydrochloride (1:2)
Formula:C9H9N3·2ClH
InChI:InChI=1S/C9H9N3.2ClH/c10-12-8-5-1-3-7-4-2-6-11-9(7)8;;/h1-6,12H,10H2;2*1H
InChI key:InChIKey=MZVBHTUMFBIRJZ-UHFFFAOYSA-N
SMILES:N(N)C=1C2=C(C=CC1)C=CC=N2.Cl
Synonyms:- Quinoline, 8-hydrazino-, dihydrochloride
- Quinoline,8-hydrazino-, dihydrochloride (7CI,9CI)
- Quinoline, 8-hydrazinyl-, hydrochloride (1:2)
Sort by
Found 4 products.
8-HydrazinoQuinoline dihydrochloride
CAS:8-Hydrazinoquinoline dihydrochloride is a heterocyclic compound that contains a pyrrole ring. It is an organic compound with the molecular formula CHN. This crystalline, white solid has two asymmetric carbon atoms and a tetragonal crystal structure. It is soluble in water but not ethanol. The 8-hydrazinoquinoline dihydrochloride molecule can be used to synthesize other compounds by reacting it with various other molecules such as formaldehyde and methanol.Purity:Min. 95%8-Hydrazinoquinoline dihydrochloride
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:232.110000610351568-Hydrazinoquinoline dihydrochloride
CAS:8-Hydrazinoquinoline dihydrochlorideFormula:C9H9N3·2ClHPurity:97% (nmr) (Typical Value in Batch COA)Color and Shape: tan solidMolecular weight:232.11g/mol
