
CAS 91339-74-1: 2-amino-4-tert-amylphenol
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-4-11(2,3)8-5-6-10(13)9(12)7-8/h5-7,13H,4,12H2,1-3H3
SMILES:CCC(C)(C)c1ccc(c(c1)N)O
Synonyms:- 2-Amino-4-(2-Methylbutan-2-Yl)Phenol
Sort by
Found 3 products.
2-Amino-4-tert-amylphenol
CAS:2-Amino-4-tert-amylphenol is a nitrate compound that can be used as an oxidant. It has been shown to react with phenols, amines and thiols, leading to the formation of 2-amino-4-tertiary butylphenol. 2TAP reacts with solvents such as cyclic, cationic and acyclic solvents. It also reacts with monomers and transfer agents to form polymers. The reaction of 2TAP with acceptors leads to ionization potential, conformational changes and affinity values. 2TAP has been shown to have interactions with other molecules and proteins in the body, leading to conformational changes or affinity values.Formula:C11H17NOPurity:Min. 95%Molecular weight:179.26 g/mol2-Amino-4-(tert-pentyl)phenol
CAS:Formula:C11H17NOPurity:97%Color and Shape:SolidMolecular weight:179.2588