
CAS 916326-10-8: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate
Formula:C14H20BNO4
InChI:InChI=1S/C14H20BNO4/c1-6-18-12(17)10-7-11(9-16-8-10)15-19-13(2,3)14(4,5)20-15/h7-9H,6H2,1-5H3
SMILES:CCOC(=O)c1cc(cnc1)B1OC(C)(C)C(C)(C)O1
Synonyms:- 5-(Ethoxycarbonyl)pyridine-3-boronic acid pinacol ester
- 3-(Ethoxycarbonyl)Pyridine-5-Boronic Acid Pinacol Ester
Sort by
Found 5 products.
3-(Ethoxycarbonyl)pyridine-5-boronic acid pinacol ester
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:277.13000488281253-(Ethoxycarbonyl)pyridine-5-boronic acid pinacol ester
CAS:Formula:C14H20BNO4Purity:96%Color and Shape:SolidMolecular weight:277.12393-(Ethoxycarbonyl)pyridine-5-boronic acid pinacol ester
CAS:3-(Ethoxycarbonyl)pyridine-5-boronic acid pinacol ester is an organic compound that is used in organic synthesis. It is a pinacol ester derivative of 3-(ethoxycarbonyl)pyridine-5-boronic acid. The compound can be isolated from the reaction mixture after coupling with a boronate reagent, which makes it trackable. This pinacol ester is an intermediate for the Suzuki coupling reaction, which allows for the synthesis of various ring systems in organic chemistry. Pinacol esters are also used to produce polyesters and polycarbonates.Formula:C14H20BNO4Purity:Min. 95%Molecular weight:277.12 g/mol3-(Ethoxycarbonyl)pyridine-5-boronic acid, pinacol ester
CAS:3-(Ethoxycarbonyl)pyridine-5-boronic acid, pinacol esterMolecular weight:277.12g/mol