
CAS 917-13-5: (3S,6R,9S,12R,15S,18R)-4,10,16-trimethyl-3,6,9,12,15,18-hexa(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
Formula:C33H57N3O9
InChI:InChI=1/C33H57N3O9/c1-16(2)22-31(40)43-26(20(9)10)29(38)35(14)24(18(5)6)33(42)45-27(21(11)12)30(39)36(15)23(17(3)4)32(41)44-25(19(7)8)28(37)34(22)13/h16-27H,1-15H3/t22-,23-,24-,25+,26+,27+/m0/s1
Synonyms:- (3S,6R,9S,12R,15S,18R)-3,6,9,12,15,18-Hexaisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
- 1,7,13-Trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone, 4,10,16-trimethyl-3,6,9,12,15,18-hexakis(1-methylethyl)-, (3S,6R,9S,12R,15S,18R)-
Sort by
Found 5 products.
Enniatin B
CAS:Enniatins B decreases the activation of ERK (p44/p42).Formula:C33H57N3O9Purity:98%Color and Shape:SolidMolecular weight:639.831Enniatin B
CAS:Enniatin BFormula:C33H57N3O9Purity:By hplc: 99.10% (Typical Value in Batch COA)Color and Shape: white powderMolecular weight:639.82g/molEnniatin B
CAS:Enniatin B is a cyclic hexadepsipeptide, which is a secondary metabolite produced by Fusarium species. Its structure enables it to function as an ionophore, facilitating the disruption of ion gradients across cellular membranes by forming complexes with metal cations. This ionophoric activity leads to its primary mode of action-altering cellular homeostasis and affecting various ion-dependent processes. The compound is extensively used in biochemical and pharmacological research due to its ability to interfere with multiple biological pathways. Enniatin B's potential applications extend to studies on cancer cell apoptosis, thanks to its capacity to induce cell death, and as a model compound in the research of ionophore activity and its impact on cellular physiology. Its role in modulating ion transport makes it a valuable tool for understanding the cellular and molecular mechanisms of ion-dependent biological processes.Purity:Min. 95%