CAS 91840-27-6: N-(dithiocarboxy)-N-methyl-D-glucamine sodium salt monoh.
Formula:C8H16NNaO5S2
InChI:InChI=1/C8H17NO5S2.Na/c1-9(8(15)16)2-4(11)6(13)7(14)5(12)3-10;/h4-7,10-14H,2-3H2,1H3,(H,15,16);/q;+1/p-1/t4-,5+,6+,7+;/m0./s1/rC8H16NNaO5S2/c1-9(8(16)17-10)2-4(12)6(14)7(15)5(13)3-11/h4-7,11-15H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1
SMILES:CN(CC(C(C(C(CO)O)O)O)O)C(=S)S.[Na]
Synonyms:- N-(Dithiocarboxy)-N-methyl-D-glucamine sodium salt monohydrate
- sodium (2S,3S,4R,5R)-1-[(disulfanylmethyl)(methyl)amino]-3,4,5,6-tetrahydroxyhexan-2-olate (non-preferred name)
Sort by
Found 4 products.
MDCG sodium
CAS:MDCG sodium (N-methyl-N-dithiocarboxyglucamine sodium) is a metal chelator that promotes biliary excretion of Cd.Formula:C8H16NNaO5S2Purity:98.31% - 98.47%Color and Shape:SolidMolecular weight:293.34N-(Dithiocarboxy)-N-methyl-D-glucamine sodium salt
CAS:N-(Dithiocarboxy)-N-methyl-D-glucamine sodium salt is a carbohydrate that can be synthesized by the reaction of D-glucamine with 2,4,6-trichlorobenzene dicarboxylic acid. This product is often used as a modifying agent for saccharides and oligosaccharides. N-(Dithiocarboxy)-N-methyl-D-glucamine sodium salt has CAS No. 91840-27-6 and the molecular formula C12H14Cl3NO5S2Na. The molecular weight is 503.95 g/mol.Formula:C8H16NO5S2NaPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:293.34 g/mol
