
CAS 92614-86-3: 3-(1H-tetrazol-1-yl)propanoic acid
Formula:C4H6N4O2
InChI:InChI=1/C4H6N4O2/c9-4(10)1-2-8-3-5-6-7-8/h3H,1-2H2,(H,9,10)
SMILES:C(Cn1cnnn1)C(=O)O
Synonyms:- 1H-tetrazole-1-propanoic acid
Sort by
Found 2 products.
3-(1H-Tetrazol-1-yl)propanoic acid
CAS:3-(1H-Tetrazol-1-yl)propanoic acid is a cation that has been shown to form hydrogen bonds with anions in the crystal. 3-(1H-Tetrazol-1-yl)propanoic acid is assembled into a supramolecular structure, which is composed of octahedral and tetrahedral units. The cations interact with anions through the process of ligand coordination.Formula:C4H6N4O2Purity:Min. 95%Molecular weight:142.12 g/mol3-Tetrazol-1-yl-propionic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:142.1179962158203