
CAS 932-51-4: Dimethylcyclohexanone, 95%
Formula:C8H14O
InChI:InChI=1S/C8H14O/c1-6-3-4-7(2)8(9)5-6/h6-7H,3-5H2,1-2H3
SMILES:CC1CCC(C)C(=O)C1
Synonyms:- 2,5-Dimethylcyclohexanone (mixture of isomers)
Sort by
Found 5 products.
2,5-Dimethylcyclohexanone (mixture of isomers)
CAS:Formula:C8H14OPurity:>95.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:126.202,5-Dimethylcyclohexanone
CAS:2,5-Dimethylcyclohexanone is a reactive methyl ketone that can be used to synthesize organic molecules. It has been shown to react with alkyl lithium reagents such as organolithium and allyllithium. This reaction can be used to generate alcohols, amines, and other compounds. The product of the reaction depends on the type of R group on the 2,5-dimethylcyclohexanone molecule. For example, when R is an electron-withdrawing group such as a phenyl group or trans-stilbene, the product is an α-alkylated β-unsaturated ketone. When R is a hydrogen atom or methyl group, the product is an alkanol or amine respectively. 2,5-Dimethylcyclohexanone can also be used as an acceptor in conformational equilibration reactions because it has two methyl groups that are orthogonal to each otherFormula:C8H14OPurity:Min. 95%Molecular weight:126.2 g/mol2,5-dimethylcyclohexan-1-one
CAS:Formula:C8H14OPurity:95%Color and Shape:LiquidMolecular weight:126.1962