
CAS 93376-04-6: (3R,4R)-3,4-bis(3-hydroxy-4-methoxybenzyl)dihydrofuran-2(3H)-one
Formula:C20H22O6
InChI:InChI=1/C20H22O6/c1-24-18-5-3-12(9-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-19(25-2)17(22)10-13/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
Synonyms:- 2(3H)-Furanone, dihydro-3,4-bis((3-hydroxy-4-methoxyphenyl)methyl)-, (3R-trans)-
Sort by
Found 1 products.
Prestegane B - Hewittia subloblata
CAS:Prestegane B is a bioactive compound, which is a natural product extracted from the plant Hewittia sublobata. This compound is sourced from the leaves and stems of the plant, which have been traditionally used in various folk medicines. The extraction process involves detailed phytochemical analysis to isolate the active constituents. Prestegane B operates by modulating specific biochemical pathways, particularly by interacting with cellular receptors and enzymes, ultimately influencing cellular processes and signaling cascades. This mode of action suggests potential applications in modulating inflammatory responses or acting as an antioxidant. The uses and applications of Prestegane B are primarily in the field of medicinal research, where it holds promise as a lead compound for drug development in treating various ailments. Its pharmacological profile is being explored for its efficacy in neurological, anti-inflammatory, and antioxidative contexts. Ongoing studies aim to elucidate its full therapeutic potential and underlying mechanisms, contributing valuable insights to the field of natural product research and pharmacognosy.Formula:C20H22O6Purity:Min. 95%Molecular weight:358.39 g/mol