
CAS 943832-81-3: Florpyrauxifen
Formula:C13H8Cl2F2N2O3
InChI:InChI=1S/C13H8Cl2F2N2O3/c1-22-12-5(14)3-2-4(7(12)16)10-8(17)9(18)6(15)11(19-10)13(20)21/h2-3H,1H3,(H2,18,19)(H,20,21)
InChI key:InChIKey=XFZUQTKDBCOXPP-UHFFFAOYSA-N
SMILES:FC1=C(N=C(C(O)=O)C(Cl)=C1N)C2=C(F)C(OC)=C(Cl)C=C2
Synonyms:- 2-Pyridinecarboxylic acid, 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoro-
- Florpyrauxifen
- 4-Amino-3-chloro-5-fluoro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid
- 4-Amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoro-2-pyridinecarboxylic acid
Sort by
Found 4 products.
Florpyrauxifen
CAS:Florpyrauxifen is a synthetic auxin herbicide, which is derived from chemical synthesis. It functions by mimicking natural plant hormones called auxins, which regulate plant growth and development. The mode of action involves disrupting normal cellular function by causing uncontrolled growth, leading to plant death. This compound is primarily used in the management of invasive and nuisance broadleaf weeds in aquatic environments. Its specificity allows for efficient control of target species with minimal impact on non-target plants and surrounding ecosystems. Florpyrauxifen is particularly effective in controlling species such as hydrilla, water hyacinth, and other pervasive aquatic weeds that threaten biodiversity and water quality. Its application is a vital tool in integrated weed management strategies, enabling the restoration and preservation of aquatic habitats.Formula:C13H8Cl2F2N2O3Purity:Min. 95%Molecular weight:349.11 g/molFlorpyrauxifen
CAS:Controlled ProductFormula:C13H8Cl2F2N2O3Color and Shape:NeatMolecular weight:349.12