
CAS 95337-74-9: 6-butylpyridin-2-amine
Formula:C9H14N2
InChI:InChI=1/C9H14N2/c1-2-3-5-8-6-4-7-9(10)11-8/h4,6-7H,2-3,5H2,1H3,(H2,10,11)
SMILES:CCCCc1cccc(N)n1
Sort by
Found 3 products.
6-butylpyridin-2-amine
CAS:6-Butylpyridin-2-amine is an organic compound with a chemical formula of C6H11N. It is a synthetic product that has been widely used as a solvent and in the synthesis of other compounds. 6-Butylpyridin-2-amine is a neutral compound that incorporates into the organic phase during extraction, which can be deprotonated to form the carboxylic acid form. The carboxylic acid form is more soluble in water than the neutral form and is also more efficient at transporting certain ions across membranes.Formula:C9H14N2Purity:Min. 95%Molecular weight:150.22 g/molRef: 3D-FB53526
Discontinued product2-Pyridinamine, 6-butyl-
CAS:Formula:C9H14N2Purity:97%Color and Shape:LiquidMolecular weight:150.22086000000002