CAS 955-15-7: 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzenesulfonamide
Formula:C11H13N3O2S
InChI:InChI=1/C11H13N3O2S/c1-8-7-9(2)14(13-8)10-3-5-11(6-4-10)17(12,15)16/h3-7H,1-2H3,(H2,12,15,16)
SMILES:Cc1cc(C)n(c2ccc(cc2)S(=O)(=O)N)n1
Synonyms:- 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzene-1-sulfonamide
- benzenesulfonamide, 4-(3,5-dimethyl-1H-pyrazol-1-yl)-
Sort by
Found 1 products.
4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzene-1-sulfonamide
CAS:4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzenesulfonamide is a centrosymmetric molecule with a dimer in the central position. It has hydrogen bonds that form between two molecules of the same type. The molecule has two hydrogen atoms bonded to each oxygen atom on the sulfonamide group and one hydrogen atom bonded to each carbon atom on the benzene ring. This molecule also has coordinated bonds, which are formed when an electron is shared by two atoms. This molecule also has symmetry in its molecular structure and can be found in nature as a component of some enzymes.Formula:C11H13N3O2SPurity:Min. 95%Molecular weight:251.31 g/mol
