![furo[3,2-d]pyrimidine-2,4(1H,3H)-dione](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F339867-furo-32-d-pyrimidine-24-1h-3h-dione.webp&w=3840&q=75)
CAS 956034-06-3: furo[3,2-d]pyrimidine-2,4(1H,3H)-dione
Formula:C6H4N2O3
InChI:InChI=1/C6H4N2O3/c9-5-4-3(1-2-11-4)7-6(10)8-5/h1-2H,(H2,7,8,9,10)
SMILES:c1coc2c1nc(nc2O)O
Synonyms:- Furo[3,2-d]pyrimidine-2,4-diol
Sort by
Found 3 products.
Furo[3,2-d]pyrimidine-2,4-diol
CAS:Formula:C6H4N2O3Purity:95%Color and Shape:SolidMolecular weight:152.10756Furo[3,2-d]pyrimidine-2,4-diol
CAS:Furo[3,2-d]pyrimidine-2,4-diol is a heterocyclic compound that has been synthesized as a potential heat stabilizer for polymers. It has an index of refraction of 1.618 and a refractive index of 1.654 at 20°C. Furo[3,2-d]pyrimidine-2,4-diol has a melting point of 175°C and decomposes at 190°C. This compound can be used to polymerize with other substances to form multilayered films that are resistant to heat degradation or photodegradation.Formula:C6H4N2O3Purity:Min. 95%Molecular weight:152.11 g/mol