
CAS 95881-22-4: 2-Ethyl-6-methylbenzonitrile
Formula:C10H11N
InChI:InChI=1/C10H11N/c1-3-9-6-4-5-8(2)10(9)7-11/h4-6H,3H2,1-2H3
SMILES:CCc1cccc(C)c1C#N
Sort by
Found 2 products.
2-Ethyl-6-methylbenzonitrile
CAS:2-Ethyl-6-methylbenzonitrile is a potent inhibitor of the enzyme alkoxycarbonylation, which is used in the synthesis of pharmaceuticals and other organic compounds. This reversible inhibitor binds to palladium and forms a covalent bond with it, forming a complex that is catalyzed by oxygen. This irreversible inhibition leads to an accumulation of 2-ethyl-6-methylbenzonitrile and prevents the production of the desired product. 2-Ethyl-6-methylbenzonitrile is more potent than its corresponding ethyl analogue because it has a greater affinity for palladium.Formula:C10H11NPurity:Min. 95%Molecular weight:145.2 g/mol2-Ethyl-6-methylbenzonitrile
CAS:2-Ethyl-6-methylbenzonitrilePurity:95Color and Shape:LiquidMolecular weight:145.20g/mol