
CAS 959-22-8: 4-Nitrophenyl benzoate
Formula:C13H9NO4
InChI:InChI=1S/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H
InChI key:InChIKey=GMKZBFFLCONHDE-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(N(=O)=O)C=C1)(=O)C2=CC=CC=C2
Synonyms:- Benzoic acid 4-nitrophenyl ester
- Benzoic acid, p-nitrophenyl ester
- NSC 408882
- Phenol, p-nitro-, benzoate
- p-Nitrophenyl benzoate
- 4-Nitrophenyl benzoate
Sort by
Found 4 products.
4-Nitrophenyl benzoate
CAS:4-Nitrophenyl benzoate is a reactive molecule that can react with oxygen nucleophiles and hydroxyl groups. 4-Nitrophenyl benzoate is formed by the acylation reaction between an amine and a phenol, which is catalyzed by acid, base, or heat. This reaction mechanism can be explained by the formation of a hydrogen bond between the amine and the phenol. The kinetic data for this reaction have been measured using fluorescence measurements, and it has been shown that the reaction rate increases as temperature increases.Formula:C13H9NO4Purity:Min. 96 Area-%Color and Shape:PowderMolecular weight:243.21 g/mol