
CAS 96254-05-6: 2-(trifluoroacetoxy)pyridine
Formula:C7H4F3NO2
InChI:InChI=1/C7H4F3NO2/c8-7(9,10)6(12)13-5-3-1-2-4-11-5/h1-4H
SMILES:c1ccnc(c1)OC(=O)C(F)(F)F
Synonyms:- Pyridin-2-Yl Trifluoroacetate
Sort by
Found 3 products.
2-(Trifluoroacetoxy)pyridine
CAS:Color and Shape:Liquid, No data available.Molecular weight:191.108993530273442-Pyridinyl trifluoroacetate
CAS:2-Pyridinyl trifluoroacetate (2PTFA) is a phosphite derivative that can be used in synthetic chemistry. It is synthesized by the reaction of naphthalene and 2-pyridinecarboxaldehyde, followed by hydrolysis with base. 2PTFA has a trifluoromethyl group and two pyridinium functional groups that are useful for various reactions. The chloride ion present in this compound allows it to be used as a reagent in the synthesis of fatty acids. 2PTFA also has physicochemical properties, such as solubility, boiling point, melting point, density, viscosity, and surface tension. It also is an intermolecular hydrogen bond donor and can form hydrogen bonds with amines and other compounds containing nitrogen atoms.Formula:C7H4F3NO2Purity:Min. 95%Molecular weight:191.11 g/mol