
CAS 96574-03-7: 3β-Hydroxylanosta-8,24-dien-21-al
Formula:C30H48O2
InChI:InChI=1S/C30H48O2/c1-20(2)9-8-10-21(19-31)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,19,21-22,25-26,32H,8,10-18H2,1-7H3/t21-,22+,25-,26-,28+,29+,30-/m0/s1
InChI key:InChIKey=BDXXTCGLJBYHHM-ILLHTMCHSA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O)CC4)[H])CC[C@]1(C)[C@@]([C@@H](CCC=C(C)C)C=O)(CC2)[H]
Synonyms:- (3β)-3-Hydroxylanosta-8,24-dien-21-al
- 3β-Hydroxylanosta-8,24-dien-21-al
- Lanosta-8,24-dien-21-al, 3-hydroxy-, (3β)-
- 3β-Hydroxylanosta-8,24-diene-21-al
Sort by
Found 1 products.
3Beta-Hydroxylanosta-8,24-diene-21-al
CAS:3Beta-Hydroxylanosta-8,24-diene-21-al is a lanostane-type triterpenoid, which is a complex organic molecule belonging to the class of naturally occurring terpenes. This compound is typically isolated from natural sources such as fungi or plants that are rich in triterpenoids, specifically from the lanostane series. The mode of action of 3Beta-Hydroxylanosta-8,24-diene-21-al involves interaction with various biological pathways, potentially modulating enzyme activity and cellular processes due to its triterpenoid structure that allows it to integrate into cellular membranes and affect membrane-bound receptors or enzymes. 3Beta-Hydroxylanosta-8,24-diene-21-al has been studied for its potential applications in pharmacology, particularly for its anti-inflammatory, anticancer, and antimicrobial properties. Its ability to influence biological pathways makes it a candidate for drug development and biochemical research. This compound's application extends to studying its effects on cell proliferation and signaling pathways, which could provide insights into novel therapeutic strategies. Researchers are particularly interested in exploring its full range of biological activities, aiming to harness its natural bioactivity for medicinal and biotechnological advancements.Formula:C30H48O2Purity:Min. 95%Molecular weight:440.70 g/mol