
CAS 96627-79-1: (3β)-17-Carboxy-28-norolean-12-en-3-yl O-α-L-arabinofuranosyl-(1→4)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranosiduronic acid
Formula:C47H74O18
InChI:InChI=1S/C47H74O18/c1-42(2)14-16-47(41(58)59)17-15-45(6)21(22(47)18-42)8-9-26-44(5)12-11-27(43(3,4)25(44)10-13-46(26,45)7)62-40-33(55)34(63-39-32(54)30(52)28(50)23(19-48)60-39)35(36(65-40)37(56)57)64-38-31(53)29(51)24(20-49)61-38/h8,22-36,38-40,48-55H,9-20H2,1-7H3,(H,56,57)(H,58,59)/t22-,23+,24-,25-,26+,27-,28+,29-,30-,31+,32+,33+,34+,35-,36-,38-,39-,40+,44-,45+,46+,47-/m0/s1
InChI key:InChIKey=OIGBNBKGCWDSEQ-GNDIVNLPSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C(O)=O)(CC3)CCC(C)(C)C4)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@H]6[C@H](O)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H](O[C@@H]8O[C@@H](CO)[C@H](O)[C@H]8O)[C@@H](C(O)=O)O6)CC5)[H])[H]
Synonyms:- (3β)-17-Carboxy-28-norolean-12-en-3-yl O-α-L-arabinofuranosyl-(1→4)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranosiduronic acid
- Stipuleanoside Rβ
- β-D-Glucopyranosiduronic acid, (3β)-17-carboxy-28-norolean-12-en-3-yl O-α-L-arabinofuranosyl-(1→4)-O-[β-D-glucopyranosyl-(1→3)]-
- Tarasaponin I
- Stipuleanoside R1
Sort by
Found 2 products.
Stipuleanoside R1
CAS:Stipuleanoside R1 is a naturally occurring glycoside, which is isolated from certain plant species, notably those in the Stipuleanaceae family. The compound functions through the inhibition of specific enzymatic pathways involved in cancer cell proliferation. Additionally, it demonstrates the ability to induce apoptosis in malignant cells by interfering with mitochondrial functions and promoting the release of cytochrome c, thereby activating the intrinsic apoptotic pathway. The primary applications of Stipuleanoside R1 are in the field of medicinal chemistry and pharmacology, where it is explored for its anticancer properties. Various studies are being conducted to further understand its pharmacokinetics and optimize its bioavailability. Researchers are particularly interested in its efficacy against resistant cancer cell lines, positioning it as a candidate for inclusion in combinatory therapy approaches. Its natural derivation also provides an advantage in terms of potential biocompatibility and reduced systemic toxicity, making it a focal point for future drug development.Formula:C47H74O18Purity:Min. 95%Molecular weight:927.1 g/molβ-D-Glucopyranosiduronic acid, (3β)-17-carboxy-28-norolean-12-en-3-yl O-α-L-arabinofuranosyl-(1→4)-O-[β-D-glucopyranosyl-(1→3)]-
CAS:Formula:C47H74O18Molecular weight:927.0797