
CAS 96905-67-8: 2-oxopyrrolidine-3-carboxylic acid
Formula:C5H7NO3
InChI:InChI=1/C5H7NO3/c7-4-3(5(8)9)1-2-6-4/h3H,1-2H2,(H,6,7)(H,8,9)
SMILES:C1CN=C(C1C(=O)O)O
Synonyms:- 3-Pyrrolidinecarboxylic Acid, 2-Oxo-
Sort by
Found 3 products.
3-Pyrrolidinecarboxylic acid, 2-oxo-
CAS:Formula:C5H7NO3Purity:97%Color and Shape:SolidMolecular weight:129.113979999999972-Oxopyrrolidine-3-carboxylic acid
CAS:2-Oxopyrrolidine-3-carboxylic acid is a carboxylic acid that has been shown to be an effective substrate for the oxidation of alcohols and racemates. The oxidative hydrolysis of 2-oxopyrrolidine-3-carboxylic acid yields lactones, which can then be used as starting materials for the synthesis of boronic esters. This molecule also has been shown to undergo aromatisation with phenylhydrazine and nitrogen atoms. 2-Oxopyrrolidine-3-carboxylic acid can be used in various reactions such as the synthesis of drugs and pharmaceuticals, pesticides, dyes, and intermediates for other chemicals.Purity:Min. 95%2-Oxo-pyrrolidine-3-carboxylic acid
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:129.11500549316406