
CAS 96905-69-0: 2,5-dioxopyrrolidine-3-carboxylic acid
Formula:C5H5NO4
InChI:InChI=1/C5H5NO4/c7-3-1-2(5(9)10)4(8)6-3/h2H,1H2,(H,9,10)(H,6,7,8)
SMILES:C1C(C(=O)N=C1O)C(=O)O
Synonyms:- 3-Pyrrolidinecarboxylic Acid, 2,5-Dioxo-
- 2,5-Dioxopyrrolidine-3-carboxylic acid
Sort by
Found 2 products.
2,5-Dioxo-pyrrolidine-3-carboxylic acid
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:143.098007202148442,5-Dioxo-pyrrolidine-3-carboxylic acid
CAS:2,5-Dioxo-pyrrolidine-3-carboxylic acid is an inhibitor of the enzyme aromatase. Aromatase is a cytochrome P450 enzyme that plays an important role in the biosynthesis of estrogens from androgens. 2,5-Dioxo-pyrrolidine-3-carboxylic acid has been shown to inhibit the production of estradiol by binding to the heme moiety of cytochrome P450 and preventing access of substrate molecules. 2,5-Dioxo-pyrrolidine-3-carboxylic acid also inhibits aromatase activity in various animal tissues, such as uterus and ovary tissue.Formula:C5H5NO4Purity:Min. 95%Molecular weight:143.09 g/mol