
CAS 97218-06-9: 2,4-Dimethoxy-3-dibenzofuranol
Formula:C14H12O4
InChI:InChI=1S/C14H12O4/c1-16-11-7-9-8-5-3-4-6-10(8)18-13(9)14(17-2)12(11)15/h3-7,15H,1-2H3
InChI key:InChIKey=IPAVEOUAXMIIKX-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C=3C(O2)=CC=CC3)=CC(OC)=C1O
Synonyms:- 2,4-Dimethoxy-3-dibenzofuranol
- 3-Dibenzofuranol, 2,4-dimethoxy-
- Eriobofuran
Sort by
Found 2 products.
3-Dibenzofuranol, 2,4-dimethoxy-
CAS:Formula:C14H12O4Purity:96.0%Color and Shape:SolidMolecular weight:244.2427Eriobofuran
CAS:Eriobofuran is a naturally occurring compound that belongs to the class of complex organic molecules. It is derived from certain plant sources, including species known for their rich secondary metabolite content. The mode of action of Eriobofuran is largely attributed to its ability to interact with biological macromolecules, potentially affecting various biochemical pathways. Eriobofuran has garnered attention in the scientific community due to its potential applications in medical and pharmaceutical research. Researchers are interested in its ability to modulate specific cellular processes, which may have implications for developing novel therapeutic agents. Additionally, its unique structural properties make it a candidate for studies exploring the interaction of natural products with biomolecular targets. Ongoing investigations are focused on elucidating the full spectrum of its biological effects and the underlying mechanisms. Such studies aim to expand the understanding of its pharmacological profile, with a focus on therapeutic potentials such as antimicrobial and anti-inflammatory properties. By exploring these avenues, scientists aim to harness the potential of Eriobofuran in developing innovative solutions to address various health challenges.Formula:C14H12O4Purity:Min. 95%Molecular weight:244.24 g/mol