
CAS 97399-94-5: (βR)-1-Methoxy-β-methyl-1H-indole-3-butanol
Formula:C14H19NO2
InChI:InChI=1S/C14H19NO2/c1-11(10-16)7-8-12-9-15(17-2)14-6-4-3-5-13(12)14/h3-6,9,11,16H,7-8,10H2,1-2H3/t11-/m1/s1
InChI key:InChIKey=FGYVMFMFZWJGDY-LLVKDONJSA-N
SMILES:C(C[C@H](CO)C)C=1C=2C(N(OC)C1)=CC=CC2
Synonyms:- (βR)-1-Methoxy-β-methyl-1H-indole-3-butanol
- Paniculidine B
- (+)-2-Methyl-4-(1-methoxyindol-3-yl)-1-butanol
- 1H-Indole-3-butanol, 1-methoxy-β-methyl-, (R)-
- 1H-Indole-3-butanol, 1-methoxy-β-methyl-, (βR)-
Sort by
Found 4 products.
Paniculidine B
CAS:Paniculidine B is a natural product of Murraya, Rutaceae.Formula:C14H19NO2Purity:98%Color and Shape:SolidMolecular weight:233.31Paniculidine B
CAS:Paniculidine B is a natural alkaloid compound, which is derived from the plant Dicranostigma lactucoides, a member of the Papaveraceae family. This compound is characterized by its complex chemical structure, which includes a distinctive arrangement of nitrogen-containing heterocycles. Paniculidine B exhibits its mode of action primarily through its interaction with microbial cell membranes and enzymes. This interaction can disrupt cellular processes, impede growth, and ultimately lead to cell death, indicating potential antimicrobial properties. The precise biochemical mechanisms underpinning these effects are still subject to ongoing research, but initial findings suggest efficacy against a range of pathogenic microbes. The uses and applications of Paniculidine B are predominantly within the realm of scientific research. It holds potential as a model compound for the development of new antimicrobial agents, thereby contributing to the field of drug discovery and development. Additionally, due to its distinct molecular framework, it may serve as a useful scaffold in synthetic chemistry for the creation of novel compounds with enhanced biological activity.Formula:C14H19NO2Purity:Min. 95%Molecular weight:233.31 g/mol1H-Indole-3-butanol, 1-methoxy-b-methyl-, (bR)-
CAS:Formula:C14H19NO2Purity:98.0%Molecular weight:233.3062