
CAS 97465-70-8: Tanshindiol B
Formula:C18H16O5
InChI:InChI=1S/C18H16O5/c1-8-7-23-17-10-3-5-11-9(4-6-12(19)18(11,2)22)14(10)16(21)15(20)13(8)17/h3,5,7,12,19,22H,4,6H2,1-2H3/t12-,18+/m0/s1
InChI key:InChIKey=RTKDBIDPGKCZJS-KPZWWZAWSA-N
SMILES:O=C1C=2C(C3=C(C1=O)C(C)=CO3)=CC=C4C2CC[C@H](O)[C@]4(C)O
Synonyms:- (6R,7S)-6,7,8,9-Tetrahydro-6,7-dihydroxy-1,6-dimethylphenanthro[1,2-b]furan-10,11-dione
- Phenanthro[1,2-b]furan-10,11-dione, 6,7,8,9-tetrahydro-6,7-dihydroxy-1,6-dimethyl-, (6R-cis)-
- Phenanthro[1,2-b]furan-10,11-dione, 6,7,8,9-tetrahydro-6,7-dihydroxy-1,6-dimethyl-, (6R,7S)-(-)-
- Tanshinodiol B
- Tanshindiol B
Sort by
Found 2 products.
Tanshindiol B
CAS:Tanshindiol B is a diterpenoid compound, which is a secondary metabolite extracted from the roots of Salvia miltiorrhiza, commonly known as danshen. This traditional Chinese medicinal plant is renowned for its rich array of bioactive constituents. The compound acts primarily through interaction with key molecular pathways involved in oxidative stress and inflammation, thus contributing to its potential therapeutic effects. Tanshindiol B is of particular interest in pharmacological research due to its ability to modulate various biochemical processes. Its anti-inflammatory and antioxidant properties make it a candidate for studies relating to cardiovascular diseases, neurodegenerative disorders, and cancer. Furthermore, it serves as a valuable tool in elucidating the molecular mechanisms underlying these conditions. Current studies are exploring its efficacy and safety profile in preclinical models, aiming to establish a foundation for potential clinical applications. As research progresses, Tanshindiol B could play a significant role in the development of novel therapeutic strategies targeting complex diseases.Formula:C18H16O5Purity:Min. 95%Molecular weight:312.30 g/molTanshindiol B
CAS:Tanshindiol B inhibits EZH2, has anti-cancer and anti-angiogenic properties, promising for designing potent inhibitors.Formula:C18H16O5Purity:98%Color and Shape:SolidMolecular weight:312.32