
CAS 98462-03-4: 8(S)-Hydroxyeicosatetraenoic acid
Formula:C20H32O3
InChI:InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-13-16-19(21)17-14-11-12-15-18-20(22)23/h6-7,9-11,13-14,16,19,21H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,14-11-,16-13+/t19-/m1/s1
InChI key:InChIKey=NLUNAYAEIJYXRB-VYOQERLCSA-N
SMILES:[C@H](C/C=C\CCCC(O)=O)(/C=C/C=C\C/C=C\CCCCC)O
Synonyms:- (5Z,8S,9E,11Z,14Z)-8-Hydroxy-5,9,11,14-eicosatetraenoic acid
- (5Z,8S,9E,11Z,14Z)-8-hydroxyicosa-5,9,11,14-tetraenoic acid
- 5,9,11,14-Eicosatetraenoic acid, 8-hydroxy-, (5Z,8S,9E,11Z,14Z)-
- 5,9,11,14-Eicosatetraenoic acid, 8-hydroxy-, [S-(E,Z,Z,Z)]-
- 8(S)-Hydroxyeicosatetraenoic acid
- 8S-Hete
Sort by
Found 4 products.
8-Hydroxyeicosatetraenoic acid
CAS:8-Hydroxyeicosatetraenoic acid is a hydroxylated metabolite, which is predominantly derived from the oxygenation of arachidonic acid. This compound acts primarily as a key intermediate in the biosynthesis of eicosanoids, which are signaling molecules associated with various physiological functions. The mode of action of 8-Hydroxyeicosatetraenoic acid involves its interaction with specific receptors and enzymes, influencing pathways that regulate inflammation, immune response, and cellular growth. 8-Hydroxyeicosatetraenoic acid is frequently studied for its role in the modulation of inflammation and its implications in diseases such as cancer, cardiovascular disorders, and neurodegenerative diseases. It is also used in research to understand the pathways involved in oxidative stress and cell signaling. As a biomarker, it provides insights into the activity of metabolic pathways involved in lipid peroxidation and is instrumental in evaluating the effects of certain therapeutic interventions. Researchers utilize this compound to further comprehend the complex network of eicosanoid metabolism and its broader impact on human health.Formula:C20H32O3Purity:Min. 95%Molecular weight:320.5 g/mol8(S)-hydroxy-5(Z),9(E),11(Z),14(Z)-eicosatetraenoic acid
CAS:Formula:C20H32O3Purity:>98%Color and Shape:In solution, EthanolMolecular weight:320.478(S)-HETE
CAS:8(S)-HETE activates mouse keratinocyte PKC (IC50: 100 μM) and PPARα (>0.3 μM); identified by chiral HPLC in murine skin.Formula:C20H32O3Color and Shape:SolidMolecular weight:320.47