
CAS 98569-64-3: Ergosta-5,24-dien-26-oic acid, 1,3,22,27-tetrahydroxy-, δ-lactone, (1α,3β,22R)-
Formula:C28H42O5
InChI:InChI=1S/C28H42O5/c1-15-11-24(33-26(32)20(15)14-29)16(2)21-7-8-22-19-6-5-17-12-18(30)13-25(31)28(17,4)23(19)9-10-27(21,22)3/h5,16,18-19,21-25,29-31H,6-14H2,1-4H3/t16-,18+,19-,21+,22-,23-,24+,25-,27+,28-/m0/s1
InChI key:InChIKey=FYYIHVSEGVWNCF-RMDUJBCISA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@H](C)[C@]5(CC(C)=C(CO)C(=O)O5)[H])(CC4)[H])[H])(CC=C1C[C@@H](O)C[C@@H]2O)[H])[H]
Synonyms:- Ergosta-5,24-dien-26-oic acid, 1,3,22,27-tetrahydroxy-, δ-lactone, (1α,3β,22R)-
- Pubesenolide
- Sominone
Sort by
Found 2 products.
Pubesenolide
CAS:Controlled ProductApplications Pubesenolide is a steroidal sapogenin that was found to improve memory impairments and increase axonal density in Alzheimer’s disease in model mice. References Joyashiki, E., et al.: Int. J. Neurosci., 121, 181 (2011); Kuroyanagi, M., et al.: Chem. Pharma. Bull., 47, 1646 (1999);Formula:C28H42O5Color and Shape:NeatMolecular weight:458.63Pubesenolide
CAS:Pubesenolide is a naturally derived compound, which is a unique type of sesquiterpene lactone sourced from specific plant species. Its mechanism of action involves modulation of biochemical pathways involved in inflammation and cellular proliferation, making it a subject of interest for pharmacological research. Pubesenolide exhibits potential in interacting with cellular components to alter gene expression profiles, specifically targeting inflammatory and proliferative processes at the molecular level. The uses and applications of Pubesenolide are primarily situated in the field of biomedical research. As scientists explore its potential therapeutic benefits, Pubesenolide is investigated for its role in developing novel anti-inflammatory drugs and cancer therapeutics. Its bioactivity suggests a capacity to intervene in key signaling pathways, positioning it as a candidate for further study in disease models characterized by dysregulated inflammation or cell growth. Due to its diverse mechanism and potential effects, Pubesenolide remains a compound of significant interest within the scientific community, promising insights into therapeutic innovation.Formula:C28H42O5Purity:Min. 95%Molecular weight:458.6 g/mol