
CAS 98834-08-3: morpholin-4-yl(piperazin-1-yl)methanone
Formula:C9H17N3O2
InChI:InChI=1/C9H17N3O2/c13-9(11-3-1-10-2-4-11)12-5-7-14-8-6-12/h10H,1-8H2
SMILES:C1CN(CCN1)C(=O)N1CCOCC1
Synonyms:- Methanone, 4-morpholinyl-1-piperazinyl-
- Morpholin-4-yl(piperazin-1-yl)methanone
Sort by
Found 4 products.
Morpholine-4-yl-piperazine-1-yl-methanone
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:199.253997802734384-(Piperazin-1-ylcarbonyl)morpholine
CAS:4-(Piperazin-1-ylcarbonyl)morpholine is a versatile compound that has various applications in different industries. It is commonly used as an intermediate in the synthesis of oxyphenisatin, dopamine, fluoroquinolones, and other pharmaceuticals. This compound also finds its use in the production of synthetic musks and carotenoids. In the field of research chemicals, 4-(Piperazin-1-ylcarbonyl)morpholine serves as a valuable tool for scientists conducting experiments and studies. Its unique properties make it an ideal candidate for investigating the interactions between exogenous nucleic acids and biological systems. Additionally, this compound has been utilized in the development of novel drugs such as pradofloxacin and etoricoxib. Furthermore, 4-(Piperazin-1-ylcarbonyl)morpholine plays a crucial role in various industrial processes. It is employed as a key ingredient in theFormula:C9H17N3O2Purity:Min. 95%Molecular weight:199.25 g/mol(Morpholin-4-yl)(piperazin-1-yl)methanone
CAS:(Morpholin-4-yl)(piperazin-1-yl)methanoneFormula:C9H17N3O2Purity:98%Color and Shape: colourless solidMolecular weight:199.25g/mol