CAS 99-21-8: N-(4-amino-5-methoxy-2-methylphenyl)benzamide
Formula:C15H16N2O2
InChI:InChI=1S/C15H16N2O2/c1-10-8-12(16)14(19-2)9-13(10)17-15(18)11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18)
InChI key:InChIKey=VENDXQNWODZJGB-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=C1)C2=CC(OC)=C(N)C=C2C
Synonyms:- 3-Amino-6-benzoylamido-4-methoxy-1-methylbenzol
- 4'-Amino-5'-methoxy-2'-methylbenzanilide
- 4-Amino-1-benzoylamino-3-methoxy-6-methylbenzene
- 4-amino-5-methoxy-2-methyl-N-phenylbenzamide
- 4′-Amino-6′-methyl-m-benzanisidide
- Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-
- Fast Violer B Base
- Fast Violet B
- Fast Violet Base B
- N-(2-Methyl-5-methoxy-4-aminophenyl)benzamide
- m-Benzanisidide, 4′-amino-6′-methyl-
- See more synonyms
Sort by
Found 5 products.
N-(4-amino-5-methoxy-2-methylphenyl)benzamide
CAS:N-(4-amino-5-methoxy-2-methylphenyl)benzamidePurity:95Color and Shape:SolidMolecular weight:256.30g/molFast Violet B - Dye content 85%
CAS:Fast Violet B is a diazonium salt that reacts with an amine, such as phosphatase, to release hydrogen. This reaction can be used to measure the activity of phosphatases. The emission of light in the visible range depends on the concentration and pH of the solution. Fast Violet B is soluble in water, alcohol, acetone, ether and chloroform. It has a particle size that ranges from 0.1-0.2 microns in diameter and will not dissolve in most solvents. Fast Violet B can be used to detect zearalenone in animal feed samples using a sample preparation technique called thin layer chromatography (TLC). It has shown clinical utility for determining antibody response in humans by measuring fatty acid synthesis activity during the inflammatory response. Fast Violet B also reacts with hydrogen bonds between nucleotides on DNA molecules and it binds to human mitochondrial DNA because it contains many phosphate groups and several intramolecular hydrogen bonds can form between neighboringFormula:C15H16N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:256.3 g/molN-(4-amino-5-methoxy-2-methylphenyl)benzamide
CAS:Formula:C15H16N2O2Purity:98%Color and Shape:SolidMolecular weight:256.2997
