
CAS 994-31-0: Triethyltin chloride
Formula:C6H15ClSn
InChI:InChI=1S/3C2H5.ClH.Sn/c3*1-2;;/h3*1H2,2H3;1H;/q;;;;+1/p-1
InChI key:InChIKey=PIMYDFDXAUVLON-UHFFFAOYSA-M
SMILES:[Sn](CC)(CC)(CC)Cl
Synonyms:- Chloro(Triethyl)Stannane
- Chlorotriethylstannane
- Chlorotriethyltin
- NSC 5283
- Stannane, chlorotriethyl-
- Triethylchlorostannane
- Triethylchlorotin
- Triethylstannyl chloride
- Triethyltinchloridecolorlessliq
- Triethyltin chloride
Sort by
Found 4 products.
Triethyltin chloride
CAS:Controlled ProductFormula:C6H15ClSnColor and Shape:NeatMolecular weight:241.35Triethyltin chloride, 98%
CAS:Triethyltin chloride, 98%Formula:(C2H5)3SnClPurity:98%Color and Shape:colorless liq.Molecular weight:241.33Chlorotriethylstannane
CAS:Chlorotriethylstannane is a chemical compound with the molecular formula CHClSn. It is an organotin compound that is used in analytical chemistry as a reagent for the quantitative determination of chloride, water vapor and fatty acids in organic solvents. Chlorotriethylstannane has been shown to have hemolytic activity, which may be due to its ability to react with p-hydroxybenzoic acid and form ester hydrochloride. The reaction mechanism is thought to involve trimethyltin, which undergoes nucleophilic substitution at the carbon atom adjacent to chlorine. Chlorotriethylstannane can be detected by plasma mass spectrometry.Formula:C6H15ClSnPurity:Min. 95%Molecular weight:241.34 g/mol