
CAS 99455-01-3: 6-iodoquinolin-2-ol
Formula:C9H6INO
InChI:InChI=1/C9H6INO/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1-5H,(H,11,12)
SMILES:c1cc(=O)[nH]c2ccc(cc12)I
Synonyms:- 6-Iodo-1H-quinolin-2-one
Sort by
Found 4 products.
6-Iodoquinolin-2-ol
CAS:6-Iodoquinolin-2-ol is a heterocyclic organic compound that is synthesized from anilines, sulfuric acid, and electron donors. This compound has been shown to react with amides and quinolines to form heterocycles. 6-Iodoquinolin-2-ol can be used in the synthesis of other heterocycles that have electron donating groups or functional groups on them. The sequence of reactions for this process is scalable, which means it can be scaled up or down to suit the needs of the experimenter.Purity:Min. 95%