
CAS 99528-42-4: (S)-(-)-1-(4-chlorophenyl)-1-ethanol
Formula:C8H9ClO
InChI:InChI=1/C8H9ClO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/m0/s1
SMILES:C[C@@H](c1ccc(cc1)Cl)O
Synonyms:- (S)-4-Chloro-Alpha-Methylbenzyl Alcohol
- (S)-4-Chloro-1-phenylethanol
- (1S)-1-(4-chlorophenyl)ethanol
- (S)-1-(4-Chloro-phenyl)-ethanol
- S-1-(4-Chloro)phenethyl Alcohol
Sort by
Found 4 products.
(S)-4-Chloro-alpha-methylbenzyl alcohol
CAS:(S)-4-Chloro-alpha-methylbenzyl alcohol is a versatile compound with multiple applications. It has antiviral properties and can inhibit the replication of certain viruses. Additionally, it acts as an intermediate in the synthesis of various bioactive compounds, including synthetic cannabinoids. This compound is water-soluble and can be easily incorporated into different formulations. (S)-4-Chloro-alpha-methylbenzyl alcohol also exhibits antioxidant activity and may have potential health benefits due to its ability to scavenge free radicals. Its unique chemical structure makes it suitable for research purposes and as a building block in the development of novel drugs or functional materials.Formula:C8H9ClOPurity:Min. 95%Molecular weight:156.61 g/mol(S)-4-Chloro-α-methylbenzyl alcohol
CAS:(S)-4-Chloro-α-methylbenzyl alcoholPurity:98%Molecular weight:156.61g/mol(S)-1-(4-Chlorophenyl)ethanol
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:156.61000061035156(S)-1-(4-Chlorophenyl)ethanol
CAS:Formula:C8H9ClOPurity:97%Color and Shape:LiquidMolecular weight:156.6095