
CAS 99624-27-8: (2S)-2',2'-dimethyl-7'-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H,2'H-2,6'-bichromene-7,8'-diol
Formula:C25H28O4
InChI:InChI=1/C25H28O4/c1-15(2)5-9-19-20(13-17-11-12-25(3,4)29-24(17)23(19)27)21-10-7-16-6-8-18(26)14-22(16)28-21/h5-6,8,11-14,21,26-27H,7,9-10H2,1-4H3/t21-/m0/s1
SMILES:CC(=CCc1c(cc2C=CC(C)(C)Oc2c1O)[C@@H]1CCc2ccc(cc2O1)O)C
Sort by
Found 4 products.
Kazinol B
CAS:Kazinol B is an inhibitor of nitric oxide (NO) production, an isopentenylated flavan with a dimethylpyran ring.Kazinol B improves insulin sensitivity byFormula:C25H28O4Purity:98%Color and Shape:SolidMolecular weight:392.49Kazinol B
CAS:Kazinol B is an isoprenylated flavonoid, which is a secondary metabolite derived from plants, predominantly found in members of the Moraceae family. It is synthesized through the plant's natural biochemical pathways, involving the modification of basic flavonoid structures via prenylation, resulting in increased lipophilicity and potential bioactivity. This compound exhibits a range of biological activities due to its mode of action, primarily influencing various cellular signaling pathways. It is known to interact with enzymes and receptors, which can modulate oxidative stress, inflammation, and cell proliferation, making it a subject of interest in biomedical research. Researchers are exploring the uses and applications of Kazinol B in contexts such as anti-inflammatory therapies, antioxidant formulations, and cancer research. Its multifunctional properties suggest potential in developing therapeutic agents targeting specific pathways in chronic diseases. Moreover, ongoing studies aim to elucidate its precise molecular interactions and optimize its bioavailability for pharmacological use.Formula:C25H28O4Purity:Min. 95%Molecular weight:392.49 g/mol