
CAS 99902-03-1: 2-thiophen-3-ylbenzaldehyde
Formula:C11H8OS
InChI:InChI=1/C11H8OS/c12-7-9-3-1-2-4-11(9)10-5-6-13-8-10/h1-8H
SMILES:c1ccc(c(c1)C=O)c1ccsc1
Synonyms:- 2-(3-Thienyl)benzaldehyde
- Benzaldehyde, 2-(3-thienyl)-
Sort by
Found 4 products.
2-(Thiophen-3-yl)benzaldehyde
CAS:Formula:C11H8OSPurity:%Color and Shape:LiquidMolecular weight:188.24562-Thiophen-3-yl-benzaldehyde
CAS:2-Thiophen-3-yl-benzaldehyde is a research chemical with various potential applications. It has been studied for its antibiotic properties, specifically as a ribosome-inactivating agent. Additionally, it has shown interactions with glutamate and muscarinic receptors, suggesting potential therapeutic effects in neurological disorders. This compound has also demonstrated antinociceptive properties, indicating its potential as an analgesic. Furthermore, 2-Thiophen-3-yl-benzaldehyde has been investigated as an inhibitor of thymidylate synthase, an enzyme involved in DNA synthesis. Its ability to interact with saponins and nuclear components further highlights its versatility for research purposes.Formula:C11H8OSPurity:Min. 95%Molecular weight:188.24 g/mol