CAS 1570-06-5: 5,6,7-Trimethoxy-2-(2-methoxyphenyl)-4H-1-benzopyran-4-on
Beschreibung:
5,6,7-Trimethoxy-2-(2-methoxyphenyl)-4H-1-benzopyran-4-on, mit der CAS-Nummer 1570-06-5, ist eine synthetische organische Verbindung, die zur Klasse der Flavonoide gehört, spezifisch ein Benzopyran-Derivat. Diese Verbindung weist eine komplexe Struktur auf, die durch einen Benzopyran-Kern gekennzeichnet ist, der mit drei Methoxygruppen und einer zusätzlichen Methoxyphenylgruppe substituiert ist, was zu ihren einzigartigen chemischen Eigenschaften beiträgt. Sie wird typischerweise für ihre potenziellen biologischen Aktivitäten anerkannt, einschließlich antioxidativer, entzündungshemmender und krebsbekämpfender Eigenschaften, die Gegenstand verschiedener pharmakologischer Studien waren. Das Vorhandensein mehrerer Methoxygruppen erhöht ihre Lipophilie, was potenziell ihre Bioverfügbarkeit und Interaktion mit biologischen Zielen beeinflussen kann. In Bezug auf die Löslichkeit ist sie in der Regel in organischen Lösungsmitteln besser löslich als in Wasser, was für viele Flavonoid-Derivate typisch ist. Ihre molekulare Struktur ermöglicht verschiedene chemische Reaktionen, was sie zu einer interessanten Verbindung in der medizinischen Chemie und der Synthese von Naturstoffen macht. Insgesamt veranschaulicht 5,6,7-Trimethoxy-2-(2-methoxyphenyl)-4H-1-benzopyran-4-on die vielfältigen Funktionen von Flavonoiden in biologischen Systemen.
Formel:C19H18O6
InChl:InChI=1S/C19H18O6/c1-21-13-8-6-5-7-11(13)14-9-12(20)17-15(25-14)10-16(22-2)18(23-3)19(17)24-4/h5-10H,1-4H3
InChI Key:InChIKey=VJQCNJZQBZZIKI-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=CC2=O)C3=C(OC)C=CC=C3)=CC(OC)=C1OC
Synonyme:- Flavone, 2′,5,6,7-tetramethoxy-
- 5,6,7-Trimethoxy-2-(2-methoxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5,6,7-trimethoxy-2-(2-methoxyphenyl)-
Sortieren nach
1 Produkte.
5,6,7,2'-Tetramethoxyflavone
CAS:5,6,7,2'-Tetramethoxyflavone is a naturally occurring flavonoid, which is a type of polyphenolic compound. It is predominantly sourced from various plant species known for their medicinal properties. Flavonoids are typically derived from the intricate biochemical pathways in plants, where they contribute to the plant's defense mechanisms against environmental stressors. The mode of action of 5,6,7,2'-Tetramethoxyflavone involves modulation of various cellular pathways. It exhibits potential antioxidant activity by scavenging free radicals, thereby reducing oxidative stress in cells. Additionally, it can influence signaling pathways that are crucial for cell proliferation and apoptosis, which underscores its potential therapeutic applications. The applications of 5,6,7,2'-Tetramethoxyflavone are diverse and primarily centered around its pharmacological properties. Research indicates its potential role in managing inflammatory conditions, with studies highlighting its ability to modulate inflammatory cytokines. Furthermore, investigations into its anticancer activity are ongoing, with promising data on its capacity to inhibit the growth of certain cancer cell lines. Its widespread implications in medicinal chemistry make it a compound of interest for further scientific exploration, especially in the development of new therapeutic agents.Formel:C19H18O6Reinheit:Min. 95%Molekulargewicht:342.34 g/mol
