Produktinformation
Name:Triptophenolide methyl ether
Synonyme:
- Hypolide methyl ether
Marke:Biosynth
Beschreibung:Triptophenolide methyl ether is a bioactive compound, classified as a terpene, derived from natural plant sources. It is primarily isolated from the roots of species within the *Tripterygium* genus. Terpenes are a large and varied class of organic compounds produced by a variety of plants, known for their aromatic qualities and biological activity.
The mode of action of triptophenolide methyl ether involves modulation of specific cellular pathways, often influencing inflammatory responses and immune-related processes. This mechanism is attributed to its interaction with key signaling molecules within cells, leading to altered gene expression and cellular function.
Because of these properties, triptophenolide methyl ether is of significant interest in scientific research, particularly for its potential therapeutic applications. It is being studied for its role in anti-inflammatory, immunosuppressive, and anticancer activities. Researchers are exploring its potential use in developing treatments for complex diseases such as autoimmune disorders and various cancers. Its study not only contributes to understanding complex biochemical pathways but also aids in the development of novel pharmaceutical agents.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:326.43 g/mol
Formel:C21H26O3
Reinheit:Min. 95%
InChl:InChI=1S/C21H26O3/c1-12(2)13-5-7-17-15(19(13)23-4)6-8-18-16-11-24-20(22)14(16)9-10-21(17,18)3/h5,7,12,18H,6,8-11H2,1-4H3/t18-,21+/m0/s1
InChI Key:InChIKey=JQYCSQASGZODFD-GHTZIAJQSA-N
SMILES:COc1c(C(C)C)ccc2c1CC[C@H]1C3=C(CC[C@]21C)C(=O)OC3
Technische Anfrage zu: Triptophenolide methyl ether
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.