Información del producto
Nombre:1,3-Dibromoadamantane
Marca:Biosynth
Descripción:1,3-Dibromoadamantane is an organic compound that belongs to the group of organobromides. It has a chemical structure with three bromine atoms and one carbon atom, which are bonded to each other in a triangle shape. 1,3-Dibromoadamantane is soluble in solvents such as water and methanol. The reaction yield of 1,3-dibromoadamantane is 100% when it reacts with hydrochloric acid as the catalyst under optimal conditions. The reaction also occurs at a high temperature (100 degrees Celsius) and releases energy efficiently. 1,3-Dibromoadamantane can be used as a substrate molecule for the Suzuki coupling reaction.
The coordination chemistry of 1,3-dibromoadamantane involves the formation of a square planar complex with copper ions and ammonia molecules to form copper(I) ammine complexes, which are then able to bind
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:294.03 g/mol
Fórmula:C10H14Br2
Pureza:Min. 95%
Color/Forma:Powder
InChI:InChI=1S/C10H14Br2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8H,1-6H2
Clave InChI:InChIKey=HLWZKLMEOVIWRK-UHFFFAOYSA-N
SMILES:BrC12CC3CC(C1)CC(Br)(C3)C2
Consulta técnica sobre: 1,3-Dibromoadamantane
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.