Información del producto
Nombre:Nocardamine
Marca:Biosynth
Descripción:Nocardamine is a siderophore-based antioxidant, which is naturally derived from the soil-dwelling actinobacteria known as Streptomyces. Its primary mode of action involves the chelation of metal ions, effectively sequestering them and preventing metal-catalyzed oxidation reactions. By binding to iron and other transition metals, Nocardamine mitigates oxidative stress at a cellular level, which could otherwise contribute to cellular damage and dysfunction.
In scientific applications, Nocardamine is being explored for its potential to reduce oxidative damage in various biological systems. Its ability to chelate excess metals has implications for research into neurodegenerative diseases, where metal ion dysregulation plays a noticeable role. Additionally, its antioxidative properties make it a candidate for studies focused on ameliorating oxidative stress-related cellular aging and pathology. Researchers are also investigating its use in agriculture, where it could aid in improving the stress tolerance of plants by modulating metal ion availability in soils.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:600.71 g/mol
Fórmula:C27H48N6O9
Pureza:Min. 95%
InChI:InChI=1S/C27H48N6O9/c34-22-10-14-26(38)32(41)20-8-3-6-18-30-24(36)12-15-27(39)33(42)21-9-2-5-17-29-23(35)11-13-25(37)31(40)19-7-1-4-16-28-22/h40-42H,1-21H2,(H,28,34)(H,29,35)(H,30,36)
Clave InChI:InChIKey=NHKCCADZVLTPPO-UHFFFAOYSA-N
SMILES:O=C1CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN1
Consulta técnica sobre: Nocardamine
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.