Información del producto
Nombre:Triptophenolide methyl ether
Sinónimos:
- Hypolide methyl ether
Marca:Biosynth
Descripción:Triptophenolide methyl ether is a bioactive compound, classified as a terpene, derived from natural plant sources. It is primarily isolated from the roots of species within the *Tripterygium* genus. Terpenes are a large and varied class of organic compounds produced by a variety of plants, known for their aromatic qualities and biological activity.
The mode of action of triptophenolide methyl ether involves modulation of specific cellular pathways, often influencing inflammatory responses and immune-related processes. This mechanism is attributed to its interaction with key signaling molecules within cells, leading to altered gene expression and cellular function.
Because of these properties, triptophenolide methyl ether is of significant interest in scientific research, particularly for its potential therapeutic applications. It is being studied for its role in anti-inflammatory, immunosuppressive, and anticancer activities. Researchers are exploring its potential use in developing treatments for complex diseases such as autoimmune disorders and various cancers. Its study not only contributes to understanding complex biochemical pathways but also aids in the development of novel pharmaceutical agents.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:326.43 g/mol
Fórmula:C21H26O3
Pureza:Min. 95%
InChI:InChI=1S/C21H26O3/c1-12(2)13-5-7-17-15(19(13)23-4)6-8-18-16-11-24-20(22)14(16)9-10-21(17,18)3/h5,7,12,18H,6,8-11H2,1-4H3/t18-,21+/m0/s1
Clave InChI:InChIKey=JQYCSQASGZODFD-GHTZIAJQSA-N
SMILES:COc1c(C(C)C)ccc2c1CC[C@H]1C3=C(CC[C@]21C)C(=O)OC3
Consulta técnica sobre: Triptophenolide methyl ether
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.