CAS 20086-06-0: Diosbulbina B
Descrizione:
Diosbulbina B è un composto naturale classificato come sesquiterpenoide, derivato principalmente dalla pianta Dioscorea bulbifera, comunemente nota come patata aerea. Questo composto presenta una struttura molecolare complessa caratterizzata da più anelli e gruppi funzionali, contribuendo alla sua attività biologica. Diosbulbina B ha attirato l'attenzione nella ricerca farmacologica grazie alle sue potenziali proprietà anti-infiammatorie, anti-cancro e antimicrobiche. Il suo meccanismo d'azione può coinvolgere la modulazione di vari percorsi di segnalazione, sebbene i dettagli specifici siano ancora sotto indagine. Il composto è tipicamente studiato nel contesto della medicina tradizionale e delle applicazioni terapeutiche moderne, evidenziando la sua importanza sia nell'etnofarmacologia che nella scoperta di farmaci. Inoltre, la solubilità e stabilità di Diosbulbina B possono variare a seconda del solvente e delle condizioni ambientali, che sono fattori importanti da considerare in contesti sperimentali. In generale, Diosbulbina B rappresenta un'area promettente di studio all'interno della chimica dei prodotti naturali e della ricerca medicinale.
Formula:C19H20O6
InChI:InChI=1S/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3
InChI key:InChIKey=QEANLIISUSNNDX-UHFFFAOYSA-N
SMILES:CC12C3(CC(OC3=O)C4C1CC5CC4C(=O)O5)OC(C2)C=6C=COC6
Sinonimi:- (2R,3aS,6S,6aS,7R,10R,11aR,11bS)-2-(3-Furanyl)octahydro-11b-methyl-4H-3a,6:7,10-dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione
- 4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, (2R,3aS,6S,6aS,7R,10R,11aR,11bS)-
- 4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, [2R-(2α,3aβ,6β,6aβ,7β,10β,11aα,11bβ)]-
- Diosbulbin B
Ordinare per
7 prodotti.
Diosbulbin B
CAS:Diosbulbin B has potential anti-tumor effects which may be related to influencing the immune system for the first time, it also exhibits potential hepatotoxicity.Formula:C19H20O6Purezza:95%~99%Peso molecolare:344.363Diosbulbin B
CAS:Diosbulbin B is a naturally occurring sesquiterpene lactone, which is derived primarily from the plant Dioscorea bulbifera, commonly known as "air potato" or "bitter yam." As a bioactive compound, Diosbulbin B demonstrates a mode of action that involves the induction of cytotoxicity in malignant cells, primarily through the disruption of microtubule dynamics, leading to cell cycle arrest and apoptosis. This compound has garnered attention in scientific research due to its potential applications in oncology. Diosbulbin B is studied for its ability to inhibit proliferation in various cancer cell lines, presenting a promising therapeutic approach for antitumor drug development. It is also investigated for its synergistic effects when used in combination with other chemotherapeutic agents, offering potential enhancements to current cancer treatment regimens. However, the use of Diosbulbin B requires careful evaluation due to its associated hepatotoxicity and other side effects, necessitating further research to optimize its efficacy and safety profile. The ongoing exploration of its mechanisms and applications underscores its significance in the pursuit of novel anticancer therapies.Formula:C19H20O6Purezza:Min. 98 Area-%Colore e forma:PowderPeso molecolare:344.36 g/molDiosbulbin B
CAS:Diosbulbin B is hepatotoxic and may have anti-tumor properties via immune system modulation.Formula:C19H20O6Purezza:98.92% - 99.64%Colore e forma:SolidPeso molecolare:344.36
