2-Bromo-4'-methoxy acetophenone
CAS:
Rif. 3D-FB46009
Informazioni sul prodotto
Nome:2-Bromo-4'-methoxy acetophenone
Marchio:Biosynth
Descrizione:2-Bromo-4'-methoxy acetophenone (2-BMA) is a reactive chemical that is used in the synthesis of organic compounds. It has been shown to induce neuronal death by causing an increase in intracellular calcium concentration and a decrease in extracellular potassium concentration. 2-BMA also inhibits phosphatases, which are enzymes that break down phosphoric esters, leading to an accumulation of these molecules, which can lead to cancer. 2-BMA binds to monoclonal antibodies and prevents their ability to bind with antigens on cells. This binding leads to reduced immune response and increased risk for HIV infection. 2-BMA can be synthesized by reacting bromine with 4'-methoxyacetophenone or 4'-hydroxyacetophenone under acidic conditions. The molecular geometry of the molecule is linear and its reactivity is due to the presence of a carbonyl group. The chemical shifts observed in 2-
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:229.07 g/mol
Formula:C9H9BrO2
Purezza:Min. 95%
InChI:InChI=1S/C9H9BrO2/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5H,6H2,1H3
InChI key:InChIKey=XQJAHBHCLXUGEP-UHFFFAOYSA-N
SMILES:COc1ccc(C(=O)CBr)cc1