Informazioni sul prodotto
Nome:Diosbulbin B
Marchio:Biosynth
Descrizione:Diosbulbin B is a naturally occurring sesquiterpene lactone, which is derived primarily from the plant Dioscorea bulbifera, commonly known as "air potato" or "bitter yam." As a bioactive compound, Diosbulbin B demonstrates a mode of action that involves the induction of cytotoxicity in malignant cells, primarily through the disruption of microtubule dynamics, leading to cell cycle arrest and apoptosis.
This compound has garnered attention in scientific research due to its potential applications in oncology. Diosbulbin B is studied for its ability to inhibit proliferation in various cancer cell lines, presenting a promising therapeutic approach for antitumor drug development. It is also investigated for its synergistic effects when used in combination with other chemotherapeutic agents, offering potential enhancements to current cancer treatment regimens.
However, the use of Diosbulbin B requires careful evaluation due to its associated hepatotoxicity and other side effects, necessitating further research to optimize its efficacy and safety profile. The ongoing exploration of its mechanisms and applications underscores its significance in the pursuit of novel anticancer therapies.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:344.36 g/mol
Formula:C19H20O6
Purezza:Min. 98 Area-%
Colore/Forma:Powder
InChI:InChI=1S/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3/t10-,11+,12+,13+,14-,15?,18-,19+/m0/s1
InChI key:InChIKey=QEANLIISUSNNDX-IMFQMMRKSA-N
SMILES:C[C@@]12C[C@H](c3ccoc3)O[C@@]13C[C@H](OC3=O)C1[C@H]3C[C@@H](C[C@H]12)OC3=O
Richiesta tecnica su: Diosbulbin B
Si prega di utilizzare piuttosto il carrello per richiedere un preventivo o un ordine
Si prega di utilizzare piuttosto il carrello per richiedere un preventivo o un ordine. Se si desidera richiedere un preventivo o effettuare un ordine, si prega invece di aggiungere i prodotti desiderati al carrello e poi richiedere un preventivo o un ordine dal carrello. È più veloce, più economico, e potrà beneficiare degli sconti disponibili e di altri vantaggi.