2-(4-Fluorophenoxy)propionic acid
CAS:
Rif. 3D-FF53083
Informazioni sul prodotto
Nome:2-(4-Fluorophenoxy)propionic acid
Marchio:Biosynth
Descrizione:2-(4-Fluorophenoxy)propionic acid is a phenoxy compound that is soluble in organic solvents and has a constant boiling point. It can be synthesized from 2-bromoethanol and 2-fluorobenzeneacetic acid. In the presence of an esterifying agent, such as pivalic acid or dicyclohexylcarbodiimide, 2-(4-fluorophenoxy)propionic acid reacts to form an ester with a substituent at the alpha position. The substituent on the alpha carbon influences the reactivity of the esterification reaction. For example, methyl ethers are more reactive than ethyl ethers because they have steric hindrance from the methyl group at C3. Substituents at C3 and C2 also influence reactivity because they determine whether an enantiomer or diastereomer is formed.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:184.16 g/mol
Formula:C9H9FO3
Purezza:Min. 95%
InChI:InChI=1S/C9H9FO3/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6H,1H3,(H,11,12)
InChI key:InChIKey=WIVLMXDHGGRLMP-UHFFFAOYSA-N
SMILES:CC(Oc1ccc(F)cc1)C(=O)O