

trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine
CAS:
Rif. 3D-UHA23366


Informazioni sul prodotto
Nome:trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine
Marchio:Biosynth
Descrizione:Trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine is a synthetic chemical with the chemical formula CH2=C(CH3)2OSi(CH2)2CH2N(CH3)2. It is an asymmetric synthesis of a benzocoumarin that has been shown to have hypoglycemic effects. Trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine is a constant pressure reactant in the homerwadsworthemmons reaction and was used to demonstrate the dehydration mechanism. This compound also has a chloride group and electron deficient carbonyl group that can be used for other reactions. Trans 3-(tertbutyldimethylsilyloxy)-N,Ndimethyl 1,3 butadiene 1
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:227.42 g/mol
Formula:C12H25NOSi
Purezza:Min. 95%