

2-Bromophenylhydrazine hydrochloride
CAS:
Ref. 3D-FB38824


Informação sobre produto
Nome:2-Bromophenylhydrazine hydrochloride
Marca:Biosynth
Descrição:2-Bromophenylhydrazine hydrochloride is a palladium complex with a molecular weight of 245.3 g/mol and is soluble in water. It has been shown to inhibit the growth of cancer cells in cell lines by binding to the electron deficient sites on the DNA molecule. 2-Bromophenylhydrazine hydrochloride also inhibits the synthesis of proteins essential for tumour cell growth and survival, such as triketone, an intermediate in the synthesis of cholesterol. The compound has been used as a synthetic precursor to other organic chemicals, such as polyalthenols and chlorides.
2-Bromophenylhydrazine hydrochloride is a white crystalline solid that can be easily dissolved in water or hydrochloric acid. This product does not contain any impurities and does not react with chloride or polyalthenol, which are often found in other bromophenylhydrazines.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:187.04 g/mol
Fórmula:C6H7BrN2
Pureza:Min. 95%
InChI:InChI=1S/C6H7BrN2/c7-5-3-1-2-4-6(5)9-8/h1-4,9H,8H2
Chave InChI:InChIKey=ZWMQVBSLMQSMDH-UHFFFAOYSA-N
SMILES:NNc1ccccc1Br