2-Bromo-4'-methoxy acetophenone
CAS:
Ref. 3D-FB46009
Informação sobre produto
Nome:2-Bromo-4'-methoxy acetophenone
Marca:Biosynth
Descrição:2-Bromo-4'-methoxy acetophenone (2-BMA) is a reactive chemical that is used in the synthesis of organic compounds. It has been shown to induce neuronal death by causing an increase in intracellular calcium concentration and a decrease in extracellular potassium concentration. 2-BMA also inhibits phosphatases, which are enzymes that break down phosphoric esters, leading to an accumulation of these molecules, which can lead to cancer. 2-BMA binds to monoclonal antibodies and prevents their ability to bind with antigens on cells. This binding leads to reduced immune response and increased risk for HIV infection. 2-BMA can be synthesized by reacting bromine with 4'-methoxyacetophenone or 4'-hydroxyacetophenone under acidic conditions. The molecular geometry of the molecule is linear and its reactivity is due to the presence of a carbonyl group. The chemical shifts observed in 2-
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:229.07 g/mol
Fórmula:C9H9BrO2
Pureza:Min. 95%
InChI:InChI=1S/C9H9BrO2/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5H,6H2,1H3
Chave InChI:InChIKey=XQJAHBHCLXUGEP-UHFFFAOYSA-N
SMILES:COc1ccc(C(=O)CBr)cc1