Informação sobre produto
Nome:2,3-Dimethoxyhydroquinone
Marca:Biosynth
Descrição:2,3-Dimethoxyhydroquinone is a chemical compound classified as a methoxy derivative of hydroquinone, which is commonly sourced through chemical synthesis from hydroquinone and methanol under specific catalytic conditions. This compound exhibits its mode of action through the donation of electrons, serving as a potent antioxidant by neutralizing free radicals.
Its applications are widespread in various scientific fields, primarily in the study of antioxidant mechanisms and potential therapeutic interventions. Researchers explore its potential in mitigating oxidative stress in biological systems, owing to its ability to inhibit radical-mediated damage at the molecular level. This feature makes it a candidate for further research in pharmacological and biochemical studies related to cellular protection and aging. Additionally, 2,3-Dimethoxyhydroquinone serves as a reference compound in analytical chemistry, providing insights into the behavior of similar structures under oxidative conditions. Its role in the stabilization of sensitive compounds through radical scavenging further underscores its significance in experimental and applied sciences.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:170.16 g/mol
Fórmula:C8H10O4
Pureza:Min. 95%
InChI:InChI=1S/C8H10O4/c1-11-7-5(9)3-4-6(10)8(7)12-2/h3-4,9-10H,1-2H3
Chave InChI:InChIKey=XGFABYCTEQAZOP-UHFFFAOYSA-N
SMILES:COc1c(O)ccc(O)c1OC
Consulta técnica sobre 2,3-Dimethoxyhydroquinone
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.