Informação sobre produto
Nome:4,7-Dihydroxy-2'-methoxyisoflavan
Marca:Biosynth
Descrição:4,7-Dihydroxy-2'-methoxyisoflavan is a naturally occurring isoflavan compound, which is typically extracted from various plant sources known for their medicinal properties. These sources include legumes and other plant families rich in phytoestrogens and related secondary metabolites.
As an isoflavan, 4,7-Dihydroxy-2'-methoxyisoflavan exhibits significant antioxidant activity. This mode of action involves the scavenging of free radicals and reduction of oxidative stress within biological systems, potentially inhibiting cellular damage caused by reactive oxygen species. Its chemical structure allows it to interact with target molecules in a way that neutralizes these reactive species, thereby contributing to cellular protection.
The uses and applications of 4,7-Dihydroxy-2'-methoxyisoflavan are of considerable interest in the fields of pharmacology and nutraceuticals, particularly regarding its potential role in the prevention and treatment of diseases linked to oxidative stress, such as cardiovascular diseases and certain types of cancer. Additionally, its presence in plant-derived foods or supplements makes it a subject of study for its benefits in human health and disease prevention.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:272.3 g/mol
Fórmula:C16H16O4
Pureza:Min. 95%
InChI:InChI=1S/C16H16O4/c1-19-14-5-3-2-4-11(14)13-9-20-15-8-10(17)6-7-12(15)16(13)18/h2-8,13,16-18H,9H2,1H3
Chave InChI:InChIKey=NADJEKOGUFAOLY-UHFFFAOYSA-N
SMILES:COc1ccccc1C1COc2cc(O)ccc2C1O
Consulta técnica sobre 4,7-Dihydroxy-2'-methoxyisoflavan
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.