(2-Methylphenyl)hydrazine hydrochloride
CAS:
Ref. 3D-FM117117
Informação sobre produto
Nome:(2-Methylphenyl)hydrazine hydrochloride
Marca:Biosynth
Descrição:The preparation of 2-methylphenylhydrazine hydrochloride is a two-step process. The first step is the synthesis of benzyl chloride by the reaction of benzene with hydrochloric acid in the presence of a catalyst, such as copper chloride or zinc chloride, at high temperature and pressure. The second step involves the reaction of benzyl chloride with hydrazine to form 2-methylphenylhydrazine hydrochloride. The reduction products are generated by the reduction of the nitro group to an amino group using hydrogen in the presence of a catalyst, such as palladium on carbon. This process can be facilitated by a dihedral angle between carbons 1 and 3, which facilitates a nucleophilic addition to carbonyl carbon 1. Benzene is converted into phenol by oxidation with chlorine in the presence of sodium hypochlorite or potassium permanganate.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:122.17 g/mol
Fórmula:C7H10N2
Pureza:Min. 95%
InChI:InChI=1S/C7H10N2/c1-6-4-2-3-5-7(6)9-8/h2-5,9H,8H2,1H3
Chave InChI:InChIKey=SCZGZDLUGUYLRV-UHFFFAOYSA-N
SMILES:Cc1ccccc1NN